Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A147 | Purity: >98% |
 | |
| Chemical structure of Apoptosis Activator 2 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 79183-19-0 |
|---|---|
| Purity | >98% |
| Formula | C15H9Cl2NO2 |
| Mol Weight | 306.143 |
| CoA | CoA of Apoptosis Activator 2 |
| Smiles: | ClC1=CC=C(CN2C(=O)C(=O)C3=C2C=CC=C3)C=C1Cl |
|---|
KEYWORDS: buy Apoptosis Activator 2 | Apoptosis Activator 2 supplier | purchase | cost | manufacturer | order | distributor | buy 79183-19-0 | 79183-19-0 supplier