Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A909 | Purity: >98% |
 | |
| Chemical structure of Apilimod mesylate |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 870087-36-8 |
|---|---|
| Purity | >98% |
| Formula | C25H34N6O8S2 |
| Mol Weight | 610.703 |
| CoA | CoA of Apilimod mesylate |
| Smiles: | CS(O)(=O)=O.CS(O)(=O)=O.CC1=CC=CC(\C=N\NC2=NC(OCCC3=CC=CC=N3)=NC(=C2)N2CCOCC2)=C1 |
|---|
KEYWORDS: buy Apilimod mesylate | Apilimod mesylate supplier | purchase | cost | manufacturer | order | distributor | buy 870087-36-8 | 870087-36-8 supplier