Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A364 | Purity: >98% |
 | |
| Chemical structure of AP-III-a4 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | ENOblock |
|---|---|
| CAS No. | 1177827-73-4 |
| Purity | >98% |
| Formula | C31H43FN8O3 |
| Mol Weight | 594.7233 |
| CoA | CoA of AP-III-a4 |
| Smiles: | NCCOCCOCCNC(=O)CC1=CC=C(NC2=NC(NCC3CCCCC3)=NC(NCC3=CC=C(F)C=C3)=N2)C=C1 |
|---|
KEYWORDS: buy AP-III-a4 | AP-III-a4 supplier | purchase | cost | manufacturer | order | distributor | buy 1177827-73-4 | 1177827-73-4 supplier