Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2935 | Purity: >98% |
 | |
| Chemical structure of ANT431 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | ANT-431 |
|---|---|
| CAS No. | 1639972-90-9 |
| Purity | >98% |
| Formula | C9H7N3O4S2 |
| Mol Weight | 285.3 |
| CoA | CoA of ANT431 |
| Smiles: | OC(=O)C1=C(NS(=O)(=O)C2=CC=CN=C2)SC=N1 |
|---|
KEYWORDS: buy ANT431 | ANT431 supplier | purchase | cost | manufacturer | order | distributor | buy 1639972-90-9 | 1639972-90-9 supplier