Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2426 | Purity: >98% |
 | |
| Chemical structure of AN3365 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Epetraborole |
|---|---|
| CAS No. | 1093643-37-8 |
| Purity | >98% |
| Formula | C11H16BNO4 |
| Mol Weight | 237.06 |
| CoA | CoA of AN3365 |
| Smiles: | NC[C@H]1OB(O)C2=C1C=CC=C2OCCCO |
|---|
KEYWORDS: buy AN3365 | AN3365 supplier | purchase | cost | manufacturer | order | distributor | buy 1093643-37-8 | 1093643-37-8 supplier