Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A16982 | Purity: >98% |
 | |
| Chemical structure of Amine-PEG4-VHL Ligand 1 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2863068-77-1 |
|---|---|
| Purity | >98% |
| Formula | C20H28N4O3 |
| Mol Weight | 372.4613 |
| CoA | CoA of Amine-PEG4-VHL Ligand 1 |
| Smiles: | O=C(OC(C)(C)C)N1CCN(CC=2C=NC=3C=C(C(=O)NC3C2)CC)CC1 |
|---|
KEYWORDS: buy Amine-PEG4-VHL Ligand 1 | Amine-PEG4-VHL Ligand 1 supplier | purchase | cost | manufacturer | order | distributor | buy 2863068-77-1 | 2863068-77-1 supplier