Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1792 | Purity: >98% |
 | |
| Chemical structure of AMG837 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 865231-46-5 |
|---|---|
| Purity | >98% |
| Formula | C26H21F3O3 |
| Mol Weight | 438.4383 |
| CoA | CoA of AMG837 |
| Smiles: | CC#C[C@@H](CC(O)=O)C1=CC=C(OCC2=CC=CC(=C2)C2=CC=C(C=C2)C(F)(F)F)C=C1 |
|---|
KEYWORDS: buy AMG837 | AMG837 supplier | purchase | cost | manufacturer | order | distributor | buy 865231-46-5 | 865231-46-5 supplier