Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2447 | Purity: >98% |
 | |
| Chemical structure of AMG-458 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 913376-83-7 |
|---|---|
| Purity | >98% |
| Formula | C30H29N5O5 |
| Mol Weight | 539.5818 |
| CoA | CoA of AMG-458 |
| Smiles: | COC1=CC2=NC=CC(OC3=CN=C(NC(=O)C4=C(C)N(CC(C)(C)O)N(C4=O)C4=CC=CC=C4)C=C3)=C2C=C1 |
|---|
KEYWORDS: buy AMG-458 | AMG-458 supplier | purchase | cost | manufacturer | order | distributor | buy 913376-83-7 | 913376-83-7 supplier