Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3315 | Purity: >98% |
 | |
| Chemical structure of Ambrisentan |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 177036-94-1 |
|---|---|
| Purity | >98% |
| Formula | C22H22N2O4 |
| Mol Weight | 378.4211 |
| CoA | CoA of Ambrisentan |
| Smiles: | O=C([C@H](C(OC)(C1=CC=CC=C1)C2=CC=CC=C2)OC3=NC(C)=CC(C)=N3)O |
|---|
KEYWORDS: buy Ambrisentan | Ambrisentan supplier | purchase | cost | manufacturer | order | distributor | buy 177036-94-1 | 177036-94-1 supplier