Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A10576 | Purity: >98% |
 | |
| Chemical structure of Amanin |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Amanine |
|---|---|
| CAS No. | 21150-21-0 |
| Purity | >98% |
| Formula | C39H53N9O14S |
| Mol Weight | 903.955 |
| CoA | CoA of Amanin |
| Smiles: | CC[C@H](C)[C@H]1C(=O)NCC(=O)N[C@@H]2CS(=O)C3=C(C[C@@H](C(=O)NCC(=O)N1)NC(=O)[C@@H](NC(=O)[C@@H]4C[C@H](CN4C(=O)[C@@H](NC2=O)CC(=O)O)O)[C@@H](C)[C@H](CO)O)C5=CC=CC=C5N3 |
|---|
KEYWORDS: buy Amanin | Amanin supplier | purchase | cost | manufacturer | order | distributor | buy 21150-21-0 | 21150-21-0 supplier