Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A11954 | Purity: >98% |
 | |
| Chemical structure of AM7499 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1577226-19-7 |
|---|---|
| Purity | >98% |
| Formula | C24H36O5 |
| Mol Weight | 404.5396 |
| CoA | CoA of AM7499 |
| Smiles: | CCCCOC(=O)C(C)(C)C1=CC(=C2[C@@H]3C[C@@H](CC[C@H]3C(OC2=C1)(C)C)CO)O |
|---|
KEYWORDS: buy AM7499 | AM7499 supplier | purchase | cost | manufacturer | order | distributor | buy 1577226-19-7 | 1577226-19-7 supplier