Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1386 | Purity: >98% |
 | |
| Chemical structure of AM2099 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1443373-17-8 |
|---|---|
| Purity | >98% |
| Formula | C19H13F3N4O3S2 |
| Mol Weight | 466.457 |
| CoA | CoA of AM2099 |
| Smiles: | COC1=CC(=CC=C1C1=NC=NC2=CC(=CC=C12)S(=O)(=O)NC1=NC=CS1)C(F)(F)F |
|---|
KEYWORDS: buy AM2099 | AM2099 supplier | purchase | cost | manufacturer | order | distributor | buy 1443373-17-8 | 1443373-17-8 supplier