Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1954 | Purity: >98% |
 | |
| Chemical structure of AM095 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | AM095 sodium |
|---|---|
| CAS No. | 1345614-59-6 |
| Purity | >98% |
| Formula | C27H23N2NaO5 |
| Mol Weight | 478.4717 |
| CoA | CoA of AM095 |
| Smiles: | [Na+].C[C@@H](OC(=O)NC1=C(ON=C1C)C1=CC=C(C=C1)C1=CC=C(CC([O-])=O)C=C1)C1=CC=CC=C1 |
|---|
KEYWORDS: buy AM095 | AM095 supplier | purchase | cost | manufacturer | order | distributor | buy 1345614-59-6 | 1345614-59-6 supplier