Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A11953 | Purity: >98% |
 | |
| Chemical structure of AM-1473 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Purity | >98% |
|---|---|
| Formula | C21H23N3O |
| Mol Weight | 333.4268 |
| CoA | CoA of AM-1473 |
| Smiles: | C1C[C@H](CN(C1)[C@H]2CC3=CC=CC=C3[C@H]2OC4=CC=C(C=C4)C#N)N |
|---|
KEYWORDS: buy AM-1473 | AM-1473 supplier | purchase | cost | manufacturer | order | distributor | buy | supplier