Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A16897 | Purity: >98% |
 | |
| Chemical structure of Alkyne-PEG2-TBS |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 252948-05-3 |
|---|---|
| Purity | >98% |
| Formula | C13H26O3Si |
| Mol Weight | 258.4292 |
| CoA | CoA of Alkyne-PEG2-TBS |
| Smiles: | C#CCOCCOCCO[Si](C)(C)C(C)(C)C |
|---|
KEYWORDS: buy Alkyne-PEG2-TBS | Alkyne-PEG2-TBS supplier | purchase | cost | manufacturer | order | distributor | buy 252948-05-3 | 252948-05-3 supplier