Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A9101 | Purity: >98% |
 | |
| Chemical structure of AK2292 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2984506-98-9 |
|---|---|
| Purity | >98% |
| Formula | C56H62F2N7O10PS2 |
| Mol Weight | 1126.233 |
| CoA | CoA of AK2292 |
| Smiles: | C(#CCCCN(C(CCN(C(=O)[C@H]1N(C([C@@H](NC(=O)C2=CC=3C(S2)=CC=C(C(P(OCC)(OCC)=O)(F)F)C3)[C@@](C)(C)C)=O)CCC1)C4=CC=C(C=C4)C5=NC=CS5)=O)C)C6=C7C(C(=O)N(C7)C8C(=O)NC(=O)CC8)=CC=C6 |
|---|
KEYWORDS: buy AK2292 | AK2292 supplier | purchase | cost | manufacturer | order | distributor | buy 2984506-98-9 | 2984506-98-9 supplier