Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A16124 | Purity: >98% |
 | |
| Chemical structure of AK-HW-90 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 3072856-03-9 |
|---|---|
| Purity | >98% |
| Formula | C27H29N5O2S |
| Mol Weight | 487.616 |
| CoA | CoA of AK-HW-90 |
| Smiles: | O=C(NC1=NC=2C=CC(=CC2S1)C=3C=CC=CC3OC)NC4=CC=C(C=C4)N5CCN(CC)CC5 |
|---|
KEYWORDS: buy AK-HW-90 | AK-HW-90 supplier | purchase | cost | manufacturer | order | distributor | buy 3072856-03-9 | 3072856-03-9 supplier