Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A171 | Purity: >98% |
 | |
| Chemical structure of AGI-5198 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | IDH-C35 |
|---|---|
| CAS No. | 1355326-35-0 |
| Purity | >98% |
| Formula | C27H31FN4O2 |
| Mol Weight | 462.559 |
| CoA | CoA of AGI-5198 |
| Smiles: | CC1=NC=CN1CC(=O)N(C(C(=O)NC1CCCCC1)C1=CC=CC=C1C)C1=CC=CC(F)=C1 |
|---|
KEYWORDS: buy AGI-5198 | AGI-5198 supplier | purchase | cost | manufacturer | order | distributor | buy 1355326-35-0 | 1355326-35-0 supplier