Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A018 | Purity: >98% |
 | |
| Chemical structure of AG014699 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 459868-92-9 |
|---|---|
| Purity | >98% |
| Formula | C19H21FN3O5P |
| Mol Weight | 421.3593 |
| CoA | CoA of AG014699 |
| Smiles: | OP(O)(O)=O.CNCC1=CC=C(C=C1)C1=C2CCNC(=O)C3=CC(F)=CC(N1)=C23 |
|---|
KEYWORDS: buy AG014699 | AG014699 supplier | purchase | cost | manufacturer | order | distributor | buy 459868-92-9 | 459868-92-9 supplier