Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A337 | Purity: >98% |
 | |
| Chemical structure of AG-013736 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Axitinib |
|---|---|
| CAS No. | 319460-85-0 |
| Purity | >98% |
| Formula | C22H18N4OS |
| Mol Weight | 386.47 |
| CoA | CoA of AG-013736 |
| Smiles: | CNC(=O)C1=CC=CC=C1SC1=CC2=C(C=C1)C(\C=C\C1=NC=CC=C1)=NN2 |
|---|
KEYWORDS: buy AG-013736 | AG-013736 supplier | purchase | cost | manufacturer | order | distributor | buy 319460-85-0 | 319460-85-0 supplier