Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A13452N | Purity: >98% |
 | |
| Chemical structure of AF594 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2148906-06-1 |
|---|---|
| Purity | >98% |
| Formula | C35H35N2O11S2 |
| Mol Weight | 723.789 |
| CoA | CoA of AF594 |
| Smiles: | O=C(O)C=1C=CC(C(=O)O)=C(C1)C=2C3=CC4=C(C=C3OC5=CC=6C(=CC52)C(=CC([N+]6C)(C)C)CS(=O)(=O)O)N(C)C(C=C4CS(=O)(=O)O)(C)C |
|---|
KEYWORDS: buy AF594 | AF594 supplier | purchase | cost | manufacturer | order | distributor | buy 2148906-06-1 | 2148906-06-1 supplier