Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2510 | Purity: >98% |
 | |
| Chemical structure of AF38469 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1531634-31-7 |
|---|---|
| Purity | >98% |
| Formula | C15H11F3N2O3 |
| Mol Weight | 324.2546 |
| CoA | CoA of AF38469 |
| Smiles: | CC1=NC(NC(=O)C2=CC=C(C=C2C(O)=O)C(F)(F)F)=CC=C1 |
|---|
KEYWORDS: buy AF38469 | AF38469 supplier | purchase | cost | manufacturer | order | distributor | buy 1531634-31-7 | 1531634-31-7 supplier