Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1635 | Purity: >98% |
 | |
| Chemical structure of AF-353 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 865305-30-2 |
|---|---|
| Purity | >98% |
| Formula | C14H17IN4O2 |
| Mol Weight | 400.2149 |
| CoA | CoA of AF-353 |
| Smiles: | COC1=CC(C(C)C)=C(OC2=CN=C(N)N=C2N)C=C1I |
|---|
KEYWORDS: buy AF-353 | AF-353 supplier | purchase | cost | manufacturer | order | distributor | buy 865305-30-2 | 865305-30-2 supplier