Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2259 | Purity: >98% |
 | |
| Chemical structure of AEE788 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | NVP-AEE788 |
|---|---|
| CAS No. | 497839-62-0 |
| Purity | >98% |
| Formula | C27H32N6 |
| Mol Weight | 440.5832 |
| CoA | CoA of AEE788 |
| Smiles: | CCN1CCN(CC2=CC=C(C=C2)C2=CC3=C(N[C@H](C)C4=CC=CC=C4)N=CN=C3N2)CC1 |
|---|
KEYWORDS: buy AEE788 | AEE788 supplier | purchase | cost | manufacturer | order | distributor | buy 497839-62-0 | 497839-62-0 supplier