Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2487 | Purity: >98% |
 | |
| Chemical structure of AEBSF hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 30827-99-7 |
|---|---|
| Purity | >98% |
| Formula | C8H11ClFNO2S |
| Mol Weight | 239.695 |
| CoA | CoA of AEBSF hydrochloride |
| Smiles: | Cl.NCCC1=CC=C(C=C1)S(F)(=O)=O |
|---|
KEYWORDS: buy AEBSF hydrochloride | AEBSF hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 30827-99-7 | 30827-99-7 supplier