Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1123 | Purity: >98% |
 | |
| Chemical structure of ADX-47273 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 851881-60-2 |
|---|---|
| Purity | >98% |
| Formula | C20H17F2N3O2 |
| Mol Weight | 369.3647 |
| CoA | CoA of ADX-47273 |
| Smiles: | FC1=CC=C(C=C1)C(=O)N1CCC[C@@H](C1)C1=NC(=NO1)C1=CC=C(F)C=C1 |
|---|
KEYWORDS: buy ADX-47273 | ADX-47273 supplier | purchase | cost | manufacturer | order | distributor | buy 851881-60-2 | 851881-60-2 supplier