Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A15005 | Purity: >98% |
 | |
| Chemical structure of ADPβS |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Adpbetas |
|---|---|
| CAS No. | 35094-45-2 |
| Purity | >98% |
| Formula | C10H15N5O9P2S |
| Mol Weight | 443.267 |
| CoA | CoA of ADPβS |
| Smiles: | O[C@H]1[C@H](N2C=3C(N=C2)=C(N)N=CN3)O[C@H](COP(OP(=O)(O)S)(=O)O)[C@H]1O |
|---|
KEYWORDS: buy ADPβS | ADPβS supplier | purchase | cost | manufacturer | order | distributor | buy 35094-45-2 | 35094-45-2 supplier