Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3621 | Purity: >98% |
 | |
| Chemical structure of Adenosine amine congener |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | ADAC |
|---|---|
| CAS No. | 96760-69-9 |
| Purity | >98% |
| Formula | C28H32N8O6 |
| Mol Weight | 576.6037 |
| CoA | CoA of Adenosine amine congener |
| Smiles: | OC[C@@H]1[C@H]([C@H]([C@H](N2C=NC3=C2N=CN=C3NC4=CC=C(CC(NC5=CC=C(CC(NCCN)=O)C=C5)=O)C=C4)O1)O)O |
|---|
KEYWORDS: buy Adenosine amine congener | Adenosine amine congener supplier | purchase | cost | manufacturer | order | distributor | buy 96760-69-9 | 96760-69-9 supplier