Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A536 | Purity: >98% |
 | |
| Chemical structure of ACTB-1003 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 939805-30-8 |
|---|---|
| Purity | >98% |
| Formula | C27H26F5N7O3 |
| Mol Weight | 591.5325 |
| CoA | CoA of ACTB-1003 |
| Smiles: | COCC1=C(CN2CCOCC2)N2N=CN=C(N)C2=C1C1=CC=C(NC(=O)NC2=CC(=CC=C2F)C(F)(F)F)C(F)=C1 |
|---|
KEYWORDS: buy ACTB-1003 | ACTB-1003 supplier | purchase | cost | manufacturer | order | distributor | buy 939805-30-8 | 939805-30-8 supplier