Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1145 | Purity: >98% |
 | |
| Chemical structure of ACT-678689 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1783256-96-1 |
|---|---|
| Purity | >98% |
| Formula | C23H22ClFN6O4S2 |
| Mol Weight | 565.04 |
| CoA | CoA of ACT-678689 |
| Smiles: | CC1=NN2C(S1)=NC1=C2[C@@H](N(CC1)C(=O)COC1=CC=C(NS(C)(=O)=O)N=C1Cl)C1=C(F)C=C(C)C=C1 |
|---|
KEYWORDS: buy ACT-678689 | ACT-678689 supplier | purchase | cost | manufacturer | order | distributor | buy 1783256-96-1 | 1783256-96-1 supplier