Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A772 | Purity: >98% |
 | |
| Chemical structure of ACH126447 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Helioxanthin |
|---|---|
| CAS No. | 18920-47-3 |
| Purity | >98% |
| Formula | C20H12O6 |
| Mol Weight | 348.3057 |
| CoA | CoA of ACH126447 |
| Smiles: | O=C1OCC2=C(C3=CC=C4OCOC4=C3)C3=C4OCOC4=CC=C3C=C12 |
|---|
KEYWORDS: buy ACH126447 | ACH126447 supplier | purchase | cost | manufacturer | order | distributor | buy 18920-47-3 | 18920-47-3 supplier