Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A555 | Purity: >98% |
 | |
| Chemical structure of AC710 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1351522-04-7 |
|---|---|
| Purity | >98% |
| Formula | C31H42N6O4 |
| Mol Weight | 562.703 |
| CoA | CoA of AC710 |
| Smiles: | CCN1C(C)(C)CC(CC1(C)C)OC1=CN=C(C=C1)C(=O)NC1=CC=C(NC(=O)NC2=NOC(=C2)C(C)(C)C)C=C1 |
|---|
KEYWORDS: buy AC710 | AC710 supplier | purchase | cost | manufacturer | order | distributor | buy 1351522-04-7 | 1351522-04-7 supplier