Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1040 | Purity: >98% |
 | |
| Chemical structure of AC5216 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Emapunil |
|---|---|
| CAS No. | 226954-04-7 |
| Purity | >98% |
| Formula | C23H23N5O2 |
| Mol Weight | 401.461 |
| CoA | CoA of AC5216 |
| Smiles: | CCN(CC1=CC=CC=C1)C(=O)CN1C(=O)N(C)C2=CN=C(N=C12)C1=CC=CC=C1 |
|---|
KEYWORDS: buy AC5216 | AC5216 supplier | purchase | cost | manufacturer | order | distributor | buy 226954-04-7 | 226954-04-7 supplier