Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2278 | Purity: >98% |
 | |
| Chemical structure of ABT450 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Paritaprevir |
|---|---|
| Synonyms 2 | 1221573-85-8 (Deleted CAS Registry Numbers) |
| CAS No. | 1216941-48-8 |
| Purity | >98% |
| Formula | C40H43N7O7S |
| Mol Weight | 765.877 |
| CoA | CoA of ABT450 |
| Smiles: | [H][C@@]12C[C@H](CN1C(=O)[C@H](CCCCC\C=C/[C@@H]1C[C@]1(NC2=O)C(=O)NS(=O)(=O)C1CC1)NC(=O)C1=NC=C(C)N=C1)OC1=C2C=CC=CC2=C2C=CC=CC2=N1 |
|---|
KEYWORDS: buy ABT450 | ABT450 supplier | purchase | cost | manufacturer | order | distributor | buy 1216941-48-8 | 1216941-48-8 supplier