Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A9743H | Purity: >98% |
 | |
| Chemical structure of ABBV-154 GR modulator ADC-FMOC |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | ADC11-FMOC |
|---|---|
| Synonyms 2 | ABBV-154 GRM ADC-FMOC |
| CAS No. | 2345732-75-2 |
| Purity | >98% |
| Formula | C69H84N3O15P |
| Mol Weight | 1226.3901 |
| CoA | CoA of ABBV-154 GR modulator ADC-FMOC |
| Smiles: | C(COP(OC(C)(C)C)(OC(C)(C)C)=O)(=O)[C@]12[C@]3(C)[C@@](C[C@]1(O[C@H](O2)C4=CC=C(CC5=CC(NC([C@@H](NC(CNC(OCC6C=7C(C=8C6=CC=CC8)=CC=CC7)=O)=O)CCC(OC(C)(C)C)=O)=O)=CC=C5)C=C4)[H])([C@]9([C@]([C@@H](O)C3)([C@]%10(C)C(CC9)=CC(=O)C=C%10)[H])[H])[H] |
|---|
KEYWORDS: buy ABBV-154 GR modulator ADC-FMOC | ABBV-154 GR modulator ADC-FMOC supplier | purchase | cost | manufacturer | order | distributor | buy 2345732-75-2 | 2345732-75-2 supplier