Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1007 | Purity: >98% |
 | |
| Chemical structure of AAL-993 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 269390-77-4 |
|---|---|
| Purity | >98% |
| Formula | C20H16F3N3O |
| Mol Weight | 371.3557 |
| CoA | CoA of AAL-993 |
| Smiles: | FC(F)(F)C1=CC(NC(=O)C2=CC=CC=C2NCC2=CC=NC=C2)=CC=C1 |
|---|
KEYWORDS: buy AAL-993 | AAL-993 supplier | purchase | cost | manufacturer | order | distributor | buy 269390-77-4 | 269390-77-4 supplier