Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A380 | Purity: >98% |
 | |
| Chemical structure of A-769662 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 844499-71-4 |
|---|---|
| Purity | >98% |
| Formula | C20H12N2O3S |
| Mol Weight | 360.386 |
| CoA | CoA of A-769662 |
| Smiles: | OC1=CC=CC=C1C1=CC=C(C=C1)C1=CSC2=C1C(O)=C(C#N)C(=O)N2 |
|---|
KEYWORDS: buy A-769662 | A-769662 supplier | purchase | cost | manufacturer | order | distributor | buy 844499-71-4 | 844499-71-4 supplier