Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A023 | Purity: >98% |
 | |
| Chemical structure of A-674563 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 552325-73-2 |
|---|---|
| Purity | >98% |
| Formula | C22H22N4O |
| Mol Weight | 358.4363 |
| CoA | CoA of A-674563 |
| Smiles: | CC1=NNC2=C1C=C(C=C2)C1=CN=CC(OC[C@@H](N)CC2=CC=CC=C2)=C1 |
|---|
KEYWORDS: buy A-674563 | A-674563 supplier | purchase | cost | manufacturer | order | distributor | buy 552325-73-2 | 552325-73-2 supplier