Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2445 | Purity: >98% |
 | |
| Chemical structure of A-484954 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 142557-61-7 |
|---|---|
| Purity | >98% |
| Formula | C13H15N5O3 |
| Mol Weight | 289.2899 |
| CoA | CoA of A-484954 |
| Smiles: | CCN1C(=O)N(C2CC2)C2=NC(N)=C(C=C2C1=O)C(N)=O |
|---|
KEYWORDS: buy A-484954 | A-484954 supplier | purchase | cost | manufacturer | order | distributor | buy 142557-61-7 | 142557-61-7 supplier