Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3013 | Purity: >98% |
 | |
| Chemical structure of A-381393 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 726174-00-1 |
|---|---|
| Purity | >98% |
| Formula | C20H24N4 |
| Mol Weight | 320.4314 |
| CoA | CoA of A-381393 |
| Smiles: | CC1=CC=C(C=C1C)N1CCN(CC2=NC3=CC=CC=C3N2)CC1 |
|---|
KEYWORDS: buy A-381393 | A-381393 supplier | purchase | cost | manufacturer | order | distributor | buy 726174-00-1 | 726174-00-1 supplier