Product Information:
| Cat. No.: EX-A8649 | Purity: >98% |
![]() | |
| Chemical structure of XF067-68 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2407452-79-1 |
|---|---|
| Purity | >98% |
| Formula | C52H59F4N9O7S |
| Mol Weight | 1030.14 |
| CoA | CoA of XF067-68 |
| Smiles: | O=C(C(C(C(F)(F)F)=C1)=CNC1=O)NC2=C(N3C[C@H](N([C@H](C3)C)C)C)C=CC(C4=CC(C(NCC(N[C@@H](C(C)(C)C)C(N5[C@H](C[C@@H](C5)O)C(N[C@H](C6=CC=C(C7=C(N=CS7)C)C=C6)C)=O)=O)=O)=O)=CC=C4F)=C2 |
|---|
KEYWORDS: buy XF067-68 | XF067-68 supplier | purchase | cost | manufacturer | order | distributor | buy 2407452-79-1 | 2407452-79-1 supplier


Inhibitor Specialist
