Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1712 | Purity: >98% |
 | |
| Chemical structure of Troparil |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 74163-84-1 |
|---|---|
| Purity | >98% |
| Formula | C16H21NO2 |
| Mol Weight | 259.3434 |
| CoA | CoA of Troparil |
| Smiles: | COC(=O)C1C2CCC(CC1C1=CC=CC=C1)N2C |
|---|
KEYWORDS: buy Troparil | Troparil supplier | purchase | cost | manufacturer | order | distributor | buy 74163-84-1 | 74163-84-1 supplier