Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A11339 | Purity: >98% |
 | |
| Chemical structure of Trametiglue |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2666940-97-0 |
|---|---|
| Purity | >98% |
| Formula | C25H24FIN6O5S |
| Mol Weight | 666.463 |
| CoA | CoA of Trametiglue |
| Smiles: | CC1=C2C(=C(N(C1=O)C)NC3=C(C=C(C=C3)I)F)C(=O)N(C(=O)N2C4=CC=CC(=C4)NS(=O)(=O)NC)C5CC5 |
|---|
KEYWORDS: buy Trametiglue | Trametiglue supplier | purchase | cost | manufacturer | order | distributor | buy 2666940-97-0 | 2666940-97-0 supplier