Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A10447 | Purity: >98% |
 | |
| Chemical structure of TYA-018 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2653254-31-8 |
|---|---|
| Purity | >98% |
| Formula | C15H13ClF2N4O3S2 |
| Mol Weight | 434.869 |
| CoA | CoA of TYA-018 |
| Smiles: | O=S(N(CC1=NC=C(C2=NN=C(C(F)F)O2)S1)C3=CC(Cl)=CC=C3)(CC)=O |
|---|
KEYWORDS: buy TYA-018 | TYA-018 supplier | purchase | cost | manufacturer | order | distributor | buy 2653254-31-8 | 2653254-31-8 supplier