Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A14707 | Purity: >98% |
 | |
| Chemical structure of TL13-27 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | TL 13-27 |
|---|---|
| CAS No. | 2250025-90-0 |
| Purity | >98% |
| Formula | C44H53ClN10O8S |
| Mol Weight | 917.472 |
| CoA | CoA of TL13-27 |
| Smiles: | CC(C)S(=O)(=O)C1=CC=CC=C1NC2=NC(=NC=C2Cl)NC3=CC=C(C=C3)N4CCN(CC4)CCOCCOCCNC(=O)CNC5=CC=CC6=C5C(=O)N(C6=O)C7CCCNC7=O |
|---|
KEYWORDS: buy TL13-27 | TL13-27 supplier | purchase | cost | manufacturer | order | distributor | buy 2250025-90-0 | 2250025-90-0 supplier