Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3630 | Purity: >98% |
 | |
| Chemical structure of TBOPP |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1996629-79-8 |
|---|---|
| Purity | >98% |
| Formula | C24H21F3N2O4S |
| Mol Weight | 490.495 |
| CoA | CoA of TBOPP |
| Smiles: | O=C1C=CC(S(=O)(N2CCCC2)=O)=CN1CC(C3=CC=C(C4=CC=CC(C(F)(F)F)=C4)C=C3)=O |
|---|
KEYWORDS: buy TBOPP | TBOPP supplier | purchase | cost | manufacturer | order | distributor | buy 1996629-79-8 | 1996629-79-8 supplier