Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A10243 | Purity: >98% |
 | |
| Chemical structure of Soticlestat |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | TAK-935 |
|---|---|
| Synonyms 2 | OV935 |
| CAS No. | 1429505-03-2 |
| Purity | >98% |
| Formula | C23H23N3O2 |
| Mol Weight | 373.4476 |
| CoA | CoA of Soticlestat |
| Smiles: | O=C(N1CCC(CC2=CC=CC=C2)(O)CC1)C3=C(C4=CC=NC=C4)N=CC=C3 |
|---|
KEYWORDS: buy Soticlestat | Soticlestat supplier | purchase | cost | manufacturer | order | distributor | buy 1429505-03-2 | 1429505-03-2 supplier