Product Information:
| Cat. No.: EX-A14791 | Purity: >98% |
![]() | |
| Chemical structure of ST1006 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1196994-11-2 |
|---|---|
| Purity | >98% |
| Formula | C16H20Cl2N6 |
| Mol Weight | 367.276 |
| Reference: | |
| CoA | CoA of ST1006 |
| Smiles: | CN1CCN(CC1)C2=NC(=NC(=C2)NCC3=C(C=CC=C3Cl)Cl)N |
|---|
KEYWORDS: buy ST1006 | ST1006 supplier | purchase | cost | manufacturer | order | distributor | buy 1196994-11-2 | 1196994-11-2 supplier


Inhibitor Specialist
