Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A10432 | Purity: >98% |
 | |
| Chemical structure of SID-852843 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 909859-19-4 |
|---|---|
| Purity | >98% |
| Formula | C17H15N3O5S |
| Mol Weight | 373.383 |
| CoA | CoA of SID-852843 |
| Smiles: | O=S(N1N=C(OC(C2=CC=CC=C2)=O)C=C1N)(C3=CC=C(OC)C=C3)=O |
|---|
KEYWORDS: buy SID-852843 | SID-852843 supplier | purchase | cost | manufacturer | order | distributor | buy 909859-19-4 | 909859-19-4 supplier