Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A12375 | Purity: >98% |
 | |
| Chemical structure of SABA1 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 690681-65-3 |
|---|---|
| Purity | >98% |
| Formula | C22H19ClN2O5S |
| Mol Weight | 458.915 |
| CoA | CoA of SABA1 |
| Smiles: | O=C(OCC)C1=CC=C(C=C1)NS(=O)(=O)C2=CC(=CC=C2Cl)C(=O)NC=3C=CC=CC3 |
|---|
KEYWORDS: buy SABA1 | SABA1 supplier | purchase | cost | manufacturer | order | distributor | buy 690681-65-3 | 690681-65-3 supplier